CAS 68922-87-2 is the registry number for Triethyl sodium methanetricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
Sodium triethyl methanetricarboxylate (CAS 68922-87-2) is a chemical compound with the molecular formula C10H15NaO6 and a molecular weight of 254.21 g/mol. IUPAC name: sodium triethyl methanetricarboxylate. InChIKey: UKWMITKBVUKHDA-UHFFFAOYSA-N.
| Molecular formula | C10H15NaO6 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | sodium triethyl methanetricarboxylate |
| InChIKey | UKWMITKBVUKHDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)[C-](C(=O)OCC)C(=O)OCC.[Na+] |
Computed by PubChem (NCBI)