Products 689293-67-2

CAS 689293-67-2 is the registry number for Ceftolozane Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Tert-butyl N-[2-[(5-amino-1-methylpyrazol-4-yl)carbamoylamino]ethyl]carbamate (CAS 689293-67-2) is a chemical compound with the molecular formula C12H22N6O3 and a molecular weight of 298.34 g/mol. IUPAC name: tert-butyl N-[2-[(5-amino-1-methylpyrazol-4-yl)carbamoylamino]ethyl]carbamate. InChIKey: RWKXAEKILLOHCD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N6O3
Molecular weight298.34 g/mol
IUPAC nametert-butyl N-[2-[(5-amino-1-methylpyrazol-4-yl)carbamoylamino]ethyl]carbamate
InChIKeyRWKXAEKILLOHCD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCNC(=O)NC1=C(N(N=C1)C)N

Computed by PubChem (NCBI)