Products 68959-00-2
CAS 68959-00-2 is the registry number for Acid Orange 116. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 3-[[4-[(2-ethoxy-5-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonate (CAS 68959-00-2) is a chemical compound with the molecular formula C25H21N4NaO4S and a molecular weight of 496.5 g/mol. IUPAC name: sodium 3-[[4-[(2-ethoxy-5-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonate. InChIKey: PHBKXNWUWOCVEI-UHFFFAOYSA-M.
| Molecular formula | C25H21N4NaO4S |
|---|---|
| Molecular weight | 496.5 g/mol |
| IUPAC name | sodium 3-[[4-[(2-ethoxy-5-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonate |
| InChIKey | PHBKXNWUWOCVEI-UHFFFAOYSA-M |
| SMILES | CCOC1=C(C=C(C=C1)C)N=NC2=CC=C(C3=CC=CC=C32)N=NC4=CC(=CC=C4)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)