CAS 68985-08-0 appears in our catalog under these names: 2,4–Mesitylenedisulfonyl Dichloride, 2,4-Mesitylenedisulfonyl Dichloride, >98.0%(T), 2,4-Mesitylenedisulfonyl Dichloride 98%, 2,4-Mesitylenedisulfonyl Dichloride, 97%, 97%, 2,4,6-Trimethylbenzene-1,3-disulfonyl dichloride, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100g.
2,4,6-trimethylbenzene-1,3-disulfonyl chloride (CAS 68985-08-0) is a chemical compound with the molecular formula C9H10Cl2O4S2 and a molecular weight of 317.2 g/mol. IUPAC name: 2,4,6-trimethylbenzene-1,3-disulfonyl chloride. InChIKey: LNXKRGBQKLXFTB-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O4S2 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2,4,6-trimethylbenzene-1,3-disulfonyl chloride |
| InChIKey | LNXKRGBQKLXFTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)Cl)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)