CAS 69-05-6 appears in our catalog under these names: quinacrine dihydrochloride, 95%, Mepacrine Hydrochloride, Quinacrine Dihydrochloride, >95% (HPLC), Quinacrine dihydrochloride, Quinacrine dihydrochloride/ 99.72% (existing batch purity). Offered by: Combi-blocks, Mikromol, LoGiCal, TRC, GLPBio. Available pack sizes: 100mg, 250mg, 10mg, 10g, 500mg, 50mg, 10mM (in 1ml dmso), 1g.
4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride (CAS 69-05-6) is a chemical compound with the molecular formula C23H32Cl3N3O and a molecular weight of 472.9 g/mol. IUPAC name: 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride. InChIKey: UDKVBVICMUEIKS-UHFFFAOYSA-N.
| Molecular formula | C23H32Cl3N3O |
|---|---|
| Molecular weight | 472.9 g/mol |
| IUPAC name | 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride |
| InChIKey | UDKVBVICMUEIKS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.Cl.Cl |
Computed by PubChem (NCBI)