CAS 69-22-7 appears in our catalog under these names: Caffeine citrate, 95%, Caffeine Citrate, >95% (HPLC), Caffeine Citrate, Caffeine, citrated, Caffeine citrate, min. 48 %, 50 g. Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, Biosynth. Available pack sizes: 1g, 500g, 100g, 25g, 5g, 2,5g, 250mg, 10mg.
2-hydroxypropane-1,2,3-tricarboxylic acid;1,3,7-trimethylpurine-2,6-dione (CAS 69-22-7) is a chemical compound with the molecular formula C14H18N4O9 and a molecular weight of 386.31 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid;1,3,7-trimethylpurine-2,6-dione. InChIKey: RCQXSQPPHJPGOF-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O9 |
|---|---|
| Molecular weight | 386.31 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1,3,7-trimethylpurine-2,6-dione |
| InChIKey | RCQXSQPPHJPGOF-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2C)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)