CAS 69004-15-5 appears in our catalog under these names: Toltrazuril sulfoxide, Toltrazuril Sulfoxide, rac Toltrazuril Sulfoxide, >95% (HPLC), Toltrazuril-sulfoxide, TOLTRAZURIL SULFOXIDE VETRANAL. Offered by: GLPBio, Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: 5mg, on request, 250mg, 25mg, 10mg, 1mg, 1x10mg, 1x1ml.
1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfinyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione (CAS 69004-15-5) is a chemical compound with the molecular formula C18H14F3N3O5S and a molecular weight of 441.4 g/mol. IUPAC name: 1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfinyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione. InChIKey: QWKYIPKCLAUFCM-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N3O5S |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | 1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfinyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione |
| InChIKey | QWKYIPKCLAUFCM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C)OC3=CC=C(C=C3)S(=O)C(F)(F)F |
Computed by PubChem (NCBI)