CAS 6901-14-0 appears in our catalog under these names: Colchicine EP Impurity G (纬-Lumicolchicine), Colchicine EP Impurity G (γ-Lumicolchicine), Gamma-Lumi (-)-Colchicine, >95% (HPLC), γ–Lumicolchicine, γ-Lumi (-)-colchicine. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 10mg, 50mg, 100mg, 1 mg.
N-[(10S,12S,16R)-3,4,5,14-tetramethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl]acetamide (CAS 6901-14-0) is a chemical compound with the molecular formula C22H25NO6 and a molecular weight of 399.4 g/mol. IUPAC name: N-[(10S,12S,16R)-3,4,5,14-tetramethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl]acetamide. InChIKey: VKPVZFOUXUQJMW-LXIYXOSZSA-N.
| Molecular formula | C22H25NO6 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | N-[(10S,12S,16R)-3,4,5,14-tetramethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl]acetamide |
| InChIKey | VKPVZFOUXUQJMW-LXIYXOSZSA-N |
| SMILES | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=C1[C@@H]4[C@H]3C=C(C4=O)OC)OC)OC)OC |
Computed by PubChem (NCBI)