CAS 69022-83-9 is the registry number for 2-Methylfuro[3,2-b]pyridine 4-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-oxidofuro[3,2-b]pyridin-4-ium (CAS 69022-83-9) is a chemical compound with the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. IUPAC name: 2-methyl-4-oxidofuro[3,2-b]pyridin-4-ium. InChIKey: CPSZOYQJBZGBGA-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2 |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | 2-methyl-4-oxidofuro[3,2-b]pyridin-4-ium |
| InChIKey | CPSZOYQJBZGBGA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=CC=[N+]2[O-] |
Computed by PubChem (NCBI)