CAS 6905-05-1 appears in our catalog under these names: 1-(broMoMethyl)-4-fluoro-1-naphthalene, 98%, 98%, 1–(Bromomethyl)–4–fluoronaphthalene, 1-(Bromomethyl)-4-fluoronaphthalene 98%. Offered by: Chemat, GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(bromomethyl)-4-fluoronaphthalene (CAS 6905-05-1) is a chemical compound with the molecular formula C11H8BrF and a molecular weight of 239.08 g/mol. IUPAC name: 1-(bromomethyl)-4-fluoronaphthalene. InChIKey: PNTIVILDAFJORJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF |
|---|---|
| Molecular weight | 239.08 g/mol |
| IUPAC name | 1-(bromomethyl)-4-fluoronaphthalene |
| InChIKey | PNTIVILDAFJORJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)CBr |
Computed by PubChem (NCBI)