CAS 69050-79-9 appears in our catalog under these names: 2,6-Di-tert-butylpyrimidin-4(1H)-one, 98%, 2,6-Di-tert-butyl-3,4-dihydropyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
2,4-ditert-butyl-1H-pyrimidin-6-one (CAS 69050-79-9) is a chemical compound with the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. IUPAC name: 2,4-ditert-butyl-1H-pyrimidin-6-one. InChIKey: PZLGMNBLXLMEIM-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 2,4-ditert-butyl-1H-pyrimidin-6-one |
| InChIKey | PZLGMNBLXLMEIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)NC(=N1)C(C)(C)C |
Computed by PubChem (NCBI)