CAS 69050-90-4 appears in our catalog under these names: 2,6-Di-tert-butylpyrimidin-4-amine, 2,6-Di-tert-butylpyrimidin-4-amine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 10g, 5g.
2,6-ditert-butylpyrimidin-4-amine (CAS 69050-90-4) is a chemical compound with the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. IUPAC name: 2,6-ditert-butylpyrimidin-4-amine. InChIKey: BOVPBWMWRQMJNO-UHFFFAOYSA-N.
| Molecular formula | C12H21N3 |
|---|---|
| Molecular weight | 207.32 g/mol |
| IUPAC name | 2,6-ditert-butylpyrimidin-4-amine |
| InChIKey | BOVPBWMWRQMJNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=N1)C(C)(C)C)N |
Computed by PubChem (NCBI)