CAS 6906-37-2 is the registry number for D-Mannuronic Acid 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
D-mannonic acid is the D-stereoisomer of mannonic acid. It is a conjugate acid of a D-mannonate.
Source: ChEBI
| Molecular formula | C6H12O7 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| InChIKey | RGHNJXZEOKUKBD-MBMOQRBOSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O)O |
Computed by PubChem (NCBI)