CAS 690624-51-2 is the registry number for (1R,2R)-N1-(2-(Diphenylphosphino)benzyl)cyclohexane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-N-[(2-diphenylphosphanylphenyl)methyl]cyclohexane-1,2-diamine (CAS 690624-51-2) is a chemical compound with the molecular formula C25H29N2P and a molecular weight of 388.5 g/mol. IUPAC name: trans-(1R,2R)-2-N-[(2-diphenylphosphanylphenyl)methyl]cyclohexane-1,2-diamine. InChIKey: WUNIFWZIPAROKM-DNQXCXABSA-N.
| Molecular formula | C25H29N2P |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | trans-(1R,2R)-2-N-[(2-diphenylphosphanylphenyl)methyl]cyclohexane-1,2-diamine |
| InChIKey | WUNIFWZIPAROKM-DNQXCXABSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)NCC2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)