CAS 690632-71-4 is the registry number for 2-(Bromomethyl)-5-methylbenzo[b]thiophene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(bromomethyl)-5-methyl-1-benzothiophene (CAS 690632-71-4) is a chemical compound with the molecular formula C10H9BrS and a molecular weight of 241.15 g/mol. IUPAC name: 2-(bromomethyl)-5-methyl-1-benzothiophene. InChIKey: VJAFXWSYMNJXKK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrS |
|---|---|
| Molecular weight | 241.15 g/mol |
| IUPAC name | 2-(bromomethyl)-5-methyl-1-benzothiophene |
| InChIKey | VJAFXWSYMNJXKK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=C2)CBr |
Computed by PubChem (NCBI)