CAS 690632-72-5 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzo[b]furan-7-boronic acid, 98%, (5-Bromo-2,3-dihydrobenzofuran-7-yl)boronic acid, 95%, 5-Bromo-2,3-dihydrobenzo[b]furan-7-boronic acid, 97%, May contain varying amounts of anhydride . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 1g, 5g, 250MG.
(5-bromo-2,3-dihydro-1-benzofuran-7-yl)boronic acid (CAS 690632-72-5) is a chemical compound with the molecular formula C8H8BBrO3 and a molecular weight of 242.86 g/mol. IUPAC name: (5-bromo-2,3-dihydro-1-benzofuran-7-yl)boronic acid. InChIKey: BSSWVOKZPQTKGW-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO3 |
|---|---|
| Molecular weight | 242.86 g/mol |
| IUPAC name | (5-bromo-2,3-dihydro-1-benzofuran-7-yl)boronic acid |
| InChIKey | BSSWVOKZPQTKGW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=C1OCC2)Br)(O)O |
Computed by PubChem (NCBI)