CAS 690632-79-2 is the registry number for 4-(1,3-Dithiolan-2-yl)aniline hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,3-dithiolan-2-yl)aniline;hydrochloride (CAS 690632-79-2) is a chemical compound with the molecular formula C9H12ClNS2 and a molecular weight of 233.8 g/mol. IUPAC name: 4-(1,3-dithiolan-2-yl)aniline;hydrochloride. InChIKey: LKKCUUGDPVRRSM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNS2 |
|---|---|
| Molecular weight | 233.8 g/mol |
| IUPAC name | 4-(1,3-dithiolan-2-yl)aniline;hydrochloride |
| InChIKey | LKKCUUGDPVRRSM-UHFFFAOYSA-N |
| SMILES | C1CSC(S1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)