CAS 690636-04-5 appears in our catalog under these names: 7-Bromo-2-phenylthieno[3,2-c]pyridin-4(5h)-one, 95%, 7-Bromo-2-phenylthieno[3,2-c]pyridin-4(5H)-one 98%, 7-Bromo-2-phenylthieno[3,2-c]pyridin-4(5H)-one, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
7-bromo-2-phenyl-5H-thieno[3,2-c]pyridin-4-one (CAS 690636-04-5) is a chemical compound with the molecular formula C13H8BrNOS and a molecular weight of 306.18 g/mol. IUPAC name: 7-bromo-2-phenyl-5H-thieno[3,2-c]pyridin-4-one. InChIKey: JWHAVYSRYAOUCX-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNOS |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 7-bromo-2-phenyl-5H-thieno[3,2-c]pyridin-4-one |
| InChIKey | JWHAVYSRYAOUCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)C(=CNC3=O)Br |
Computed by PubChem (NCBI)