CAS 690664-20-1 appears in our catalog under these names: Methyl (E)-3-(2-amino-3-fluorophenyl)acrylate, 98%, Tedizolid Impurity 79. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-3-(2-amino-3-fluorophenyl)prop-2-enoate (CAS 690664-20-1) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: methyl (E)-3-(2-amino-3-fluorophenyl)prop-2-enoate. InChIKey: QSQJNLFKFYTKST-AATRIKPKSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | methyl (E)-3-(2-amino-3-fluorophenyl)prop-2-enoate |
| InChIKey | QSQJNLFKFYTKST-AATRIKPKSA-N |
| SMILES | COC(=O)/C=C/C1=C(C(=CC=C1)F)N |
Computed by PubChem (NCBI)