CAS 69086-72-2 is the registry number for Lycoperdic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-[(2S)-2-amino-2-carboxyethyl]-5-oxooxolane-2-carboxylic acid (CAS 69086-72-2) is a chemical compound with the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. IUPAC name: (2S)-2-[(2S)-2-amino-2-carboxyethyl]-5-oxooxolane-2-carboxylic acid. InChIKey: ZQVZYZVRVFBTDG-NVNXEXLPSA-N.
| Molecular formula | C8H11NO6 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | (2S)-2-[(2S)-2-amino-2-carboxyethyl]-5-oxooxolane-2-carboxylic acid |
| InChIKey | ZQVZYZVRVFBTDG-NVNXEXLPSA-N |
| SMILES | C1C[C@](OC1=O)(C[C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)