CAS 690996-25-9 appears in our catalog under these names: Estetrol Impurity 1, 15,16-Deshydroxy 3-O-Benzyl Estetrol 17-Acetate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg, 5mg.
[(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthren-17-yl] acetate (CAS 690996-25-9) is a chemical compound with the molecular formula C27H30O3 and a molecular weight of 402.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthren-17-yl] acetate. InChIKey: FBNSBVRDAJVLAM-SEFGFODJSA-N.
| Molecular formula | C27H30O3 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | FBNSBVRDAJVLAM-SEFGFODJSA-N |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OCC5=CC=CC=C5)C |
Computed by PubChem (NCBI)