CAS 69123-90-6 appears in our catalog under these names: Fiacitabine, 95%, Fiacitabine, Fiacitabine, 98+%, Fiacitabine/ 99.21% (existing batch purity), Fiacitabine, ≥98%, ≥98%. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1mg, 5mg, 10mg, 25mg, 50mg.
4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one (CAS 69123-90-6) is a chemical compound with the molecular formula C9H11FIN3O4 and a molecular weight of 371.10 g/mol. IUPAC name: 4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one. InChIKey: GIMSJJHKKXRFGV-BYPJNBLXSA-N.
| Molecular formula | C9H11FIN3O4 |
|---|---|
| Molecular weight | 371.10 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
| InChIKey | GIMSJJHKKXRFGV-BYPJNBLXSA-N |
| SMILES | C1=C(C(=NC(=O)N1[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F)N)I |
Computed by PubChem (NCBI)