CAS 69123-98-4 appears in our catalog under these names: Fialuridine, 98%, Fialuridine 98%, 1-(2-Deoxy-2-fluoro-β-D-arabinofuranosyl)-5-iodouracil, 98%, 98%, 1-(2'-Deoxy-2'-fluoro-β-D-arabinofuranos, yl)-5-iodouracil, 100 mg, Fialuridine, 95%. Offered by: Thermo Scientific (Acros), Ambeed, Chemat, Roth, Combi-blocks. Available pack sizes: 100MG, 250mg, 1g, 5g, 10mg, 5mg, 25mg, 500mg.
1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione (CAS 69123-98-4) is a chemical compound with the molecular formula C9H10FIN2O5 and a molecular weight of 372.09 g/mol. IUPAC name: 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione. InChIKey: IPVFGAYTKQKGBM-BYPJNBLXSA-N.
| Molecular formula | C9H10FIN2O5 |
|---|---|
| Molecular weight | 372.09 g/mol |
| IUPAC name | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| InChIKey | IPVFGAYTKQKGBM-BYPJNBLXSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F)I |
Computed by PubChem (NCBI)