Products 691386-78-4
CAS 691386-78-4 is the registry number for EU1622-1. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 5mg, 25mg.
5-(4-chlorophenyl)-6-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one (CAS 691386-78-4) is a chemical compound with the molecular formula C19H18ClN3O2S and a molecular weight of 387.9 g/mol. IUPAC name: 5-(4-chlorophenyl)-6-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one. InChIKey: KHRRGSKOOLJVDL-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN3O2S |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-6-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one |
| InChIKey | KHRRGSKOOLJVDL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=CN(C2=O)CC(=O)N3CCCC3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)