Products 883003-06-3
CAS 883003-06-3 is the registry number for 2-((4-chlorophenyl)sulfonyl)-3-(4-phenylpiperazinyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
(E)-2-(4-chlorophenyl)sulfonyl-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile (CAS 883003-06-3) is a chemical compound with the molecular formula C19H18ClN3O2S and a molecular weight of 387.9 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)sulfonyl-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile. InChIKey: ZMGMTESYTNDFMT-XDJHFCHBSA-N.
| Molecular formula | C19H18ClN3O2S |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)sulfonyl-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile |
| InChIKey | ZMGMTESYTNDFMT-XDJHFCHBSA-N |
| SMILES | C1CN(CCN1/C=C(\C#N)/S(=O)(=O)C2=CC=C(C=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)