CAS 69173-96-2 appears in our catalog under these names: 2,3,4,6-Tetrafluorobenzonitrile, 97%, 2,3,4,6-Tetrafluorobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,3,4,6-tetrafluorobenzonitrile (CAS 69173-96-2) is a chemical compound with the molecular formula C7HF4N and a molecular weight of 175.08 g/mol. IUPAC name: 2,3,4,6-tetrafluorobenzonitrile. InChIKey: XWDUWNUFQUWNNG-UHFFFAOYSA-N.
| Molecular formula | C7HF4N |
|---|---|
| Molecular weight | 175.08 g/mol |
| IUPAC name | 2,3,4,6-tetrafluorobenzonitrile |
| InChIKey | XWDUWNUFQUWNNG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)C#N)F |
Computed by PubChem (NCBI)