Products 69175-16-2

CAS 69175-16-2 is the registry number for 2',3'-Diphenyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4-(4-carboxyphenyl)-2,3-diphenylphenyl]benzoic acid (CAS 69175-16-2) is a chemical compound with the molecular formula C32H22O4 and a molecular weight of 470.5 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,3-diphenylphenyl]benzoic acid. InChIKey: VXEMRLSIYMCFQA-UHFFFAOYSA-N.

Identity
Molecular formulaC32H22O4
Molecular weight470.5 g/mol
IUPAC name4-[4-(4-carboxyphenyl)-2,3-diphenylphenyl]benzoic acid
InChIKeyVXEMRLSIYMCFQA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(C=CC(=C2C3=CC=CC=C3)C4=CC=C(C=C4)C(=O)O)C5=CC=C(C=C5)C(=O)O

Computed by PubChem (NCBI)