CAS 67546-18-3 is the registry number for 4,4'-((1E,1'E)-Anthracene-9,10-diylbis(ethene-2,1-diyl))dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-2-[10-[(E)-2-(4-carboxyphenyl)ethenyl]anthracen-9-yl]ethenyl]benzoic acid (CAS 67546-18-3) is a chemical compound with the molecular formula C32H22O4 and a molecular weight of 470.5 g/mol. IUPAC name: 4-[(E)-2-[10-[(E)-2-(4-carboxyphenyl)ethenyl]anthracen-9-yl]ethenyl]benzoic acid. InChIKey: ATNHSEKOZXABDI-IWGRKNQJSA-N.
| Molecular formula | C32H22O4 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 4-[(E)-2-[10-[(E)-2-(4-carboxyphenyl)ethenyl]anthracen-9-yl]ethenyl]benzoic acid |
| InChIKey | ATNHSEKOZXABDI-IWGRKNQJSA-N |
| SMILES | C1=CC=C2C(=C3C(=C(C2=C1)/C=C/C4=CC=C(C=C4)C(=O)O)C=CC=C3)/C=C/C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)