Products 691863-84-0

CAS 691863-84-0 is the registry number for Butylphthalide Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-pentyl-2,3-dihydroisoindol-1-one (CAS 691863-84-0) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 3-pentyl-2,3-dihydroisoindol-1-one. InChIKey: UDTBMOVPABGZEV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO
Molecular weight203.28 g/mol
IUPAC name3-pentyl-2,3-dihydroisoindol-1-one
InChIKeyUDTBMOVPABGZEV-UHFFFAOYSA-N
SMILESCCCCCC1C2=CC=CC=C2C(=O)N1

Computed by PubChem (NCBI)