Products 691869-12-2
CAS 691869-12-2 is the registry number for EP4 receptor agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-methylphenoxy)-2-phenylthieno[3,2-d]pyrimidine (CAS 691869-12-2) is a chemical compound with the molecular formula C19H14N2OS and a molecular weight of 318.4 g/mol. IUPAC name: 4-(4-methylphenoxy)-2-phenylthieno[3,2-d]pyrimidine. InChIKey: BLTGDXMNAWRERE-UHFFFAOYSA-N.
| Molecular formula | C19H14N2OS |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 4-(4-methylphenoxy)-2-phenylthieno[3,2-d]pyrimidine |
| InChIKey | BLTGDXMNAWRERE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=NC(=NC3=C2SC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)