CAS 691877-05-1 appears in our catalog under these names: 3-Iodo-5-(trifluoromethyl)benzonitrile, 95%, 3-Iodo-5-(trifluoromethyl)benzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-iodo-5-(trifluoromethyl)benzonitrile (CAS 691877-05-1) is a chemical compound with the molecular formula C8H3F3IN and a molecular weight of 297.02 g/mol. IUPAC name: 3-iodo-5-(trifluoromethyl)benzonitrile. InChIKey: PZPKHYOVFCEKBO-UHFFFAOYSA-N.
| Molecular formula | C8H3F3IN |
|---|---|
| Molecular weight | 297.02 g/mol |
| IUPAC name | 3-iodo-5-(trifluoromethyl)benzonitrile |
| InChIKey | PZPKHYOVFCEKBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)I)C#N |
Computed by PubChem (NCBI)