CAS 691881-93-3 is the registry number for (1S)-1-(2,5-Dichlorophenyl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(1S)-1-(2,5-dichlorophenyl)ethanol (CAS 691881-93-3) is a chemical compound with the molecular formula C8H8Cl2O and a molecular weight of 191.05 g/mol. IUPAC name: (1S)-1-(2,5-dichlorophenyl)ethanol. InChIKey: RDMKUSDLLGKMCK-YFKPBYRVSA-N.
| Molecular formula | C8H8Cl2O |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (1S)-1-(2,5-dichlorophenyl)ethanol |
| InChIKey | RDMKUSDLLGKMCK-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)