Products 691881-96-6
CAS 691881-96-6 appears in our catalog under these names: (S)-1-(2,3-Difluorophenyl)ethanol, 95%, 95%, (S)-1-(2,3-Difluorophenyl)ethan-1-ol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 5g.
(1S)-1-(2,3-difluorophenyl)ethanol (CAS 691881-96-6) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1S)-1-(2,3-difluorophenyl)ethanol. InChIKey: IWMIWBJLOWDKSQ-YFKPBYRVSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1S)-1-(2,3-difluorophenyl)ethanol |
| InChIKey | IWMIWBJLOWDKSQ-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)F)F)O |
Computed by PubChem (NCBI)