CAS 6919-96-6 is the registry number for Gastrodin Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl acetate (CAS 6919-96-6) is a chemical compound with the molecular formula C14H19BrO9 and a molecular weight of 411.20 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl acetate. InChIKey: CYAYKKUWALRRPA-RKQHYHRCSA-N.
| Molecular formula | C14H19BrO9 |
|---|---|
| Molecular weight | 411.20 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl acetate |
| InChIKey | CYAYKKUWALRRPA-RKQHYHRCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)Br)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)