CAS 69193-35-7 is the registry number for (1S,3R)-3-Cyano-2,2-dimethylcyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-(1R,3S)-3-cyano-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 69193-35-7) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: trans-(1R,3S)-3-cyano-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: AAWCRIBGDUFUKB-WHFBIAKZSA-N.
| Molecular formula | C7H9NO2 |
|---|---|
| Molecular weight | 139.15 g/mol |
| IUPAC name | trans-(1R,3S)-3-cyano-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | AAWCRIBGDUFUKB-WHFBIAKZSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O)C#N)C |
Computed by PubChem (NCBI)