Products 6920-31-6
CAS 6920-31-6 appears in our catalog under these names: Isobutyryl L-Carnitine Chloride, >95% (HPLC), Isobutyryl–L–carnitine chloride, Isobutyryl-L-carnitine chloride, Isobutyryl-L-carnitine (chloride), Isobutyryl-L-carnitine (chloride), 98.0%. Offered by: TRC, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 10mg, 2mg, 5mg, 25mg, 100 mg, 10 mg.
[(2R)-3-carboxy-2-(2-methylpropanoyloxy)propyl]-trimethylazanium chloride (CAS 6920-31-6) is a chemical compound with the molecular formula C11H22ClNO4 and a molecular weight of 267.75 g/mol. IUPAC name: [(2R)-3-carboxy-2-(2-methylpropanoyloxy)propyl]-trimethylazanium chloride. InChIKey: FWUACOYFRJEMMP-SBSPUUFOSA-N.
| Molecular formula | C11H22ClNO4 |
|---|---|
| Molecular weight | 267.75 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-(2-methylpropanoyloxy)propyl]-trimethylazanium chloride |
| InChIKey | FWUACOYFRJEMMP-SBSPUUFOSA-N |
| SMILES | CC(C)C(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)