Products 6922-62-9
CAS 6922-62-9 is the registry number for 9-Angeloylretronecine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(7R,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate (CAS 6922-62-9) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: [(7R,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate. InChIKey: VYUQPLFRNDQDHW-BTRLNGJCSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | [(7R,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (Z)-2-methylbut-2-enoate |
| InChIKey | VYUQPLFRNDQDHW-BTRLNGJCSA-N |
| SMILES | C/C=C(/C)\C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)O |
Computed by PubChem (NCBI)