CAS 69226-51-3 appears in our catalog under these names: 2,2,2-Trichloroethyl sulfamate, 97%, 2,2,2–Trichloroethyl Sulfamate, 2,2,2-Trichloroethyl sulfamate, 2,2,2-Trichloroethyl Sulfamate, >98.0%(T), 2,2,2-Trichloroethyl sulfamate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 100g, 50g.
2,2,2-trichloroethyl sulfamate (CAS 69226-51-3) is a chemical compound with the molecular formula C2H4Cl3NO3S and a molecular weight of 228.5 g/mol. IUPAC name: 2,2,2-trichloroethyl sulfamate. InChIKey: VOKONKGVTXWZJI-UHFFFAOYSA-N.
| Molecular formula | C2H4Cl3NO3S |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 2,2,2-trichloroethyl sulfamate |
| InChIKey | VOKONKGVTXWZJI-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)OS(=O)(=O)N |
Computed by PubChem (NCBI)