CAS 69232-47-9 is the registry number for Acetic acid acetoxy-(4-chlorosulfonylphenyl)methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
[acetyloxy-(4-chlorosulfonylphenyl)methyl] acetate (CAS 69232-47-9) is a chemical compound with the molecular formula C11H11ClO6S and a molecular weight of 306.72 g/mol. IUPAC name: [acetyloxy-(4-chlorosulfonylphenyl)methyl] acetate. InChIKey: MUXCHHLNVLPPPB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO6S |
|---|---|
| Molecular weight | 306.72 g/mol |
| IUPAC name | [acetyloxy-(4-chlorosulfonylphenyl)methyl] acetate |
| InChIKey | MUXCHHLNVLPPPB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=C(C=C1)S(=O)(=O)Cl)OC(=O)C |
Computed by PubChem (NCBI)