Products 692733-01-0
CAS 692733-01-0 is the registry number for N-{4-((Dimethylamino)sulfonyl)phenyl}-4-phenyltetrahydro-1(2H)-pyrazinecarboxamide. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
N-[4-(dimethylsulfamoyl)phenyl]-4-phenylpiperazine-1-carboxamide (CAS 692733-01-0) is a chemical compound with the molecular formula C19H24N4O3S and a molecular weight of 388.5 g/mol. IUPAC name: N-[4-(dimethylsulfamoyl)phenyl]-4-phenylpiperazine-1-carboxamide. InChIKey: OXUMAQZFALWDFI-UHFFFAOYSA-N.
| Molecular formula | C19H24N4O3S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | N-[4-(dimethylsulfamoyl)phenyl]-4-phenylpiperazine-1-carboxamide |
| InChIKey | OXUMAQZFALWDFI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)NC(=O)N2CCN(CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)