CAS 692739-25-6 appears in our catalog under these names: 6–Maleimidocaproic acid–PFP ester, 6-Maleimidocaproic acid pentafluorophenyl ester, 95%, 6-Maleimidocaproic acid-PFP ester 95%, 6-Maleimidocaproic acid-PFP ester, 99.62%, 6-Maleimidocaproic acid-PFP ester, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 100 mg, 250 mg.
(2,3,4,5,6-pentafluorophenyl) 6-(2,5-dioxopyrrol-1-yl)hexanoate (CAS 692739-25-6) is a chemical compound with the molecular formula C16H12F5NO4 and a molecular weight of 377.26 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 6-(2,5-dioxopyrrol-1-yl)hexanoate. InChIKey: CIQYBTAUACRWKP-UHFFFAOYSA-N.
| Molecular formula | C16H12F5NO4 |
|---|---|
| Molecular weight | 377.26 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| InChIKey | CIQYBTAUACRWKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)