Products 69275-10-1
CAS 69275-10-1 is the registry number for Anorexigenic Peptide. Offered by: Creative Peptides. Available pack sizes: on request.
2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoyl]amino]acetic acid (CAS 69275-10-1) is a chemical compound with the molecular formula C13H17N5O5 and a molecular weight of 323.30 g/mol. IUPAC name: 2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoyl]amino]acetic acid. InChIKey: GVCTYSKUHKXJDZ-IUCAKERBSA-N.
| Molecular formula | C13H17N5O5 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoyl]amino]acetic acid |
| InChIKey | GVCTYSKUHKXJDZ-IUCAKERBSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N[C@@H](CC2=CN=CN2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)