CAS 69278-56-4 is the registry number for N-Nitrosomethylethylamine-d5. Offered by: MedChemExpress. Available pack sizes: 1 mg.
N-methyl-N-(1,1,2,2,2-pentadeuterioethyl)nitrous amide (CAS 69278-56-4) is a chemical compound with the molecular formula C3H8N2O and a molecular weight of 93.14 g/mol. IUPAC name: N-methyl-N-(1,1,2,2,2-pentadeuterioethyl)nitrous amide. InChIKey: RTDCJKARQCRONF-WNWXXORZSA-N.
| Molecular formula | C3H8N2O |
|---|---|
| Molecular weight | 93.14 g/mol |
| IUPAC name | N-methyl-N-(1,1,2,2,2-pentadeuterioethyl)nitrous amide |
| InChIKey | RTDCJKARQCRONF-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C)N=O |
Computed by PubChem (NCBI)