CAS 69299-69-0 is the registry number for Terephthalonitrile-d4, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
2,3,5,6-tetradeuteriobenzene-1,4-dicarbonitrile (CAS 69299-69-0) is a chemical compound with the molecular formula C8H4N2 and a molecular weight of 132.15 g/mol. IUPAC name: 2,3,5,6-tetradeuteriobenzene-1,4-dicarbonitrile. InChIKey: BHXFKXOIODIUJO-RHQRLBAQSA-N.
| Molecular formula | C8H4N2 |
|---|---|
| Molecular weight | 132.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuteriobenzene-1,4-dicarbonitrile |
| InChIKey | BHXFKXOIODIUJO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])C#N)[2H] |
Computed by PubChem (NCBI)