CAS 69303-28-2 is the registry number for P,P′,P′′,P′′′-[1,2,4,5-Benzenetetrayltetrakis(methylene)]tetrakis[phosphonic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid (CAS 69303-28-2) is a chemical compound with the molecular formula C10H18O12P4 and a molecular weight of 454.14 g/mol. IUPAC name: [2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid. InChIKey: YIHIDHLQYGLSMH-UHFFFAOYSA-N.
| Molecular formula | C10H18O12P4 |
|---|---|
| Molecular weight | 454.14 g/mol |
| IUPAC name | [2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid |
| InChIKey | YIHIDHLQYGLSMH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)