Products 69303-28-2

CAS 69303-28-2 is the registry number for P,P′,P′′,P′′′-[1,2,4,5-Benzenetetrayltetrakis(methylene)]tetrakis[phosphonic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

[2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid (CAS 69303-28-2) is a chemical compound with the molecular formula C10H18O12P4 and a molecular weight of 454.14 g/mol. IUPAC name: [2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid. InChIKey: YIHIDHLQYGLSMH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O12P4
Molecular weight454.14 g/mol
IUPAC name[2,4,5-tris(phosphonomethyl)phenyl]methylphosphonic acid
InChIKeyYIHIDHLQYGLSMH-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O

Computed by PubChem (NCBI)