Products 693235-40-4
CAS 693235-40-4 is the registry number for FL-166. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-[[4-[(3-borono-5-nitrobenzoyl)amino]phenyl]carbamoyl]-5-nitrophenyl]boronic acid (CAS 693235-40-4) is a chemical compound with the molecular formula C20H16B2N4O10 and a molecular weight of 494.0 g/mol. IUPAC name: [3-[[4-[(3-borono-5-nitrobenzoyl)amino]phenyl]carbamoyl]-5-nitrophenyl]boronic acid. InChIKey: JBHJLTFEEOIBFO-UHFFFAOYSA-N.
| Molecular formula | C20H16B2N4O10 |
|---|---|
| Molecular weight | 494.0 g/mol |
| IUPAC name | [3-[[4-[(3-borono-5-nitrobenzoyl)amino]phenyl]carbamoyl]-5-nitrophenyl]boronic acid |
| InChIKey | JBHJLTFEEOIBFO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NC2=CC=C(C=C2)NC(=O)C3=CC(=CC(=C3)B(O)O)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)