Products 693241-47-3
CAS 693241-47-3 appears in our catalog under these names: 4-Amino-2-benzylamino-6-phenyl-1,3,5-tri, azine, 250 mg, 4-Amino-2-benzylamino-6-phenyl-1,3,5-triazine, 95%, 4-Amino-2-benzylamino-6-phenyl-1,3,5-triazine, 98%, 4-Amino-2-benzylamino-6-phenyl-1,3,5-triazine, 4-Amino-2-benzylamino-6-phenyl-1,3,5-tri, azine, 500 mg. Offered by: Roth, Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine (CAS 693241-47-3) is a chemical compound with the molecular formula C16H15N5 and a molecular weight of 277.32 g/mol. IUPAC name: 2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine. InChIKey: LDHZXIVBHWRNGD-UHFFFAOYSA-N.
| Molecular formula | C16H15N5 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | LDHZXIVBHWRNGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)