Products 69328-26-3
CAS 69328-26-3 is the registry number for 2-tert-Butylimino-5-(4-chloro-phenyl)-3-isopropyl-(1,3,5)thiadiazinan-4-one. Offered by: TRC. Available pack sizes: 750mg.
2-tert-butylimino-5-(4-chlorophenyl)-3-propan-2-yl-1,3,5-thiadiazinan-4-one (CAS 69328-26-3) is a chemical compound with the molecular formula C16H22ClN3OS and a molecular weight of 339.9 g/mol. IUPAC name: 2-tert-butylimino-5-(4-chlorophenyl)-3-propan-2-yl-1,3,5-thiadiazinan-4-one. InChIKey: RUKPMDNZGHNLPD-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN3OS |
|---|---|
| Molecular weight | 339.9 g/mol |
| IUPAC name | 2-tert-butylimino-5-(4-chlorophenyl)-3-propan-2-yl-1,3,5-thiadiazinan-4-one |
| InChIKey | RUKPMDNZGHNLPD-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=NC(C)(C)C)SCN(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)