Products 69340-07-4
CAS 69340-07-4 appears in our catalog under these names: 1,4-Dinitrosopiperazine-d8, N,N'-Dinitrosopiperazine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
2,2,3,3,5,5,6,6-octadeuterio-1,4-dinitrosopiperazine (CAS 69340-07-4) is a chemical compound with the molecular formula C4H8N4O2 and a molecular weight of 152.18 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1,4-dinitrosopiperazine. InChIKey: WNSYEWGYAFFSSQ-SVYQBANQSA-N.
| Molecular formula | C4H8N4O2 |
|---|---|
| Molecular weight | 152.18 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1,4-dinitrosopiperazine |
| InChIKey | WNSYEWGYAFFSSQ-SVYQBANQSA-N |
| SMILES | [2H]C1(C(N(C(C(N1N=O)([2H])[2H])([2H])[2H])N=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)