CAS 69347-45-1 is the registry number for 5,6-Dihydrodeoxysepiapterin Dihydrochloride. Offered by: TRC. Available pack sizes: 25mg.
2-amino-6-propanoyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride (CAS 69347-45-1) is a chemical compound with the molecular formula C9H15Cl2N5O2 and a molecular weight of 296.15 g/mol. IUPAC name: 2-amino-6-propanoyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride. InChIKey: VZSGTKAWFYUZKX-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N5O2 |
|---|---|
| Molecular weight | 296.15 g/mol |
| IUPAC name | 2-amino-6-propanoyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;dihydrochloride |
| InChIKey | VZSGTKAWFYUZKX-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1CNC2=C(N1)C(=O)NC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)